C13H20 — CID 173443886
5-methyl-6,8-dimethylidenedeca-1,2-diene (PubChem CID 173443886) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-methyl-6,8-dimethylidenedeca-1,2-diene.
| Compound Name | 5-methyl-6,8-dimethylidenedeca-1,2-diene |
|---|---|
| PubChem CID | 173443886 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-methyl-6,8-dimethylidenedeca-1,2-diene |
| SMILES | C=C=CCC(C)C(=C)CC(=C)CC |
| InChI | InChI=1S/C13H20/c1-6-8-9-12(4)13(5)10-11(3)7-2/h8,12H,1,3,5,7,9-10H2,2,4H3 |
| InChIKey | NAGFFDMBKXYYRN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|