C10H14O3 — CID 101404671
2-(3-oxobutyl)hexa-4,5-dienoic acid (PubChem CID 101404671) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-(3-oxobutyl)hexa-4,5-dienoic acid.
| Compound Name | 2-(3-oxobutyl)hexa-4,5-dienoic acid |
|---|---|
| PubChem CID | 101404671 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-(3-oxobutyl)hexa-4,5-dienoic acid |
| SMILES | C=C=CCC(CCC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H14O3/c1-3-4-5-9(10(12)13)7-6-8(2)11/h4,9H,1,5-7H2,2H3,(H,12,13) |
| InChIKey | GEAUUBNFDAMXEW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |