About 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol
3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol (PubChem CID 173447609) has the molecular formula C9H17NO11
and a molecular weight of 315.23 g/mol. Its IUPAC name is 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol.
Molecular Properties
| Compound Name | 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol |
| PubChem CID | 173447609 |
| Molecular Formula | C9H17NO11 |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol |
| SMILES | O=C(O)COOC(=O)CC(=O)O.OCCONOCCO |
| InChI | InChI=1S/C5H6O7.C4H11NO4/c6-3(7)1-5(10)12-11-2-4(8)9;6-1-3-8-5-9-4-2-7/h1-2H2,(H,6,7)(H,8,9);5-7H,1-4H2 |
| InChIKey | XENBNZQXIUSIJE-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 181.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol?
The IUPAC name of 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol (CID 173447609) is 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol.
What is the SMILES notation for 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol?
The canonical SMILES for 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol is O=C(O)COOC(=O)CC(=O)O.OCCONOCCO.
What is the InChIKey of 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol?
The InChIKey is XENBNZQXIUSIJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O7.C4H11NO4/c6-3(7)1-5(10)12-11-2-4(8)9;6-1-3-8-5-9-4-2-7/h1-2H2,(H,6,7)(H,8,9);5-7H,1-4H2.
What are the key properties of 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol?
3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol has a molecular weight of 315.23 g/mol, XLogP of -2.56, 11 rotatable bonds, 5 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(carboxymethylperoxy)-3-oxopropanoic acid;2-(2-hydroxyethoxyamino)oxyethanol is sourced from PubChem (CID 173447609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).