C26H26Fe — CID 173449048
bis(1-cyclopenta-1,4-dien-1-yl-3-ethylbenzene);iron(2+) (PubChem CID 173449048) has the molecular formula C26H26Fe and a molecular weight of 394.34 g/mol. Its IUPAC name is bis(1-cyclopenta-1,4-dien-1-yl-3-ethylbenzene);iron(2+).
| Compound Name | bis(1-cyclopenta-1,4-dien-1-yl-3-ethylbenzene);iron(2+) |
|---|---|
| PubChem CID | 173449048 |
| Molecular Formula | C26H26Fe |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | bis(1-cyclopenta-1,4-dien-1-yl-3-ethylbenzene);iron(2+) |
| SMILES | CCc1cccc(C2=[C-]CC=C2)c1.CCc1cccc(C2=[C-]CC=C2)c1.[Fe+2] |
| InChI | InChI=1S/2C13H13.Fe/c2*1-2-11-6-5-9-13(10-11)12-7-3-4-8-12;/h2*3,5-7,9-10H,2,4H2,1H3;/q2*-1;+2 |
| InChIKey | DHEHPMLNLYMUFA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|