About lithium;di(butan-2-yl)-methylborane;hydride
lithium;di(butan-2-yl)-methylborane;hydride (PubChem CID 173450477) has the molecular formula C9H22BLi
and a molecular weight of 148.03 g/mol. Its IUPAC name is lithium;di(butan-2-yl)-methylborane;hydride.
Molecular Properties
| Compound Name | lithium;di(butan-2-yl)-methylborane;hydride |
| PubChem CID | 173450477 |
| Molecular Formula | C9H22BLi |
| Molecular Weight | 148.03 g/mol |
| Exact Mass | 148.20 |
| IUPAC Name | lithium;di(butan-2-yl)-methylborane;hydride |
| SMILES | CCC(C)B(C)C(C)CC.[H-].[Li+] |
| InChI | InChI=1S/C9H21B.Li.H/c1-6-8(3)10(5)9(4)7-2;;/h8-9H,6-7H2,1-5H3;;/q;+1;-1 |
| InChIKey | QSPSJNBNQGKAPZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.03 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;di(butan-2-yl)-methylborane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;di(butan-2-yl)-methylborane;hydride?
The IUPAC name of lithium;di(butan-2-yl)-methylborane;hydride (CID 173450477) is lithium;di(butan-2-yl)-methylborane;hydride.
What is the SMILES notation for lithium;di(butan-2-yl)-methylborane;hydride?
The canonical SMILES for lithium;di(butan-2-yl)-methylborane;hydride is CCC(C)B(C)C(C)CC.[H-].[Li+].
What is the InChIKey of lithium;di(butan-2-yl)-methylborane;hydride?
The InChIKey is QSPSJNBNQGKAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21B.Li.H/c1-6-8(3)10(5)9(4)7-2;;/h8-9H,6-7H2,1-5H3;;/q;+1;-1.
What are the key properties of lithium;di(butan-2-yl)-methylborane;hydride?
lithium;di(butan-2-yl)-methylborane;hydride has a molecular weight of 148.03 g/mol, XLogP of 0.83, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;di(butan-2-yl)-methylborane;hydride is sourced from PubChem (CID 173450477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).