About di(butan-2-yl)silane
di(butan-2-yl)silane (PubChem CID 123717607) has the molecular formula C8H20Si
and a molecular weight of 144.33 g/mol. Its IUPAC name is di(butan-2-yl)silane.
Molecular Properties
| Compound Name | di(butan-2-yl)silane |
| PubChem CID | 123717607 |
| Molecular Formula | C8H20Si |
| Molecular Weight | 144.33 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | di(butan-2-yl)silane |
| SMILES | CCC(C)[SiH2]C(C)CC |
| InChI | InChI=1S/C8H20Si/c1-5-7(3)9-8(4)6-2/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | DJODXBLSFLZTSN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze di(butan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(butan-2-yl)silane?
The IUPAC name of di(butan-2-yl)silane (CID 123717607) is di(butan-2-yl)silane.
What is the SMILES notation for di(butan-2-yl)silane?
The canonical SMILES for di(butan-2-yl)silane is CCC(C)[SiH2]C(C)CC.
What is the InChIKey of di(butan-2-yl)silane?
The InChIKey is DJODXBLSFLZTSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20Si/c1-5-7(3)9-8(4)6-2/h7-8H,5-6,9H2,1-4H3.
What are the key properties of di(butan-2-yl)silane?
di(butan-2-yl)silane has a molecular weight of 144.33 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(butan-2-yl)silane is sourced from PubChem (CID 123717607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).