C13H28N4O3 — CID 173451617
methyl N-(dimethylaminomethylidene)carbamate;1-methyl-3-(4-methylpentan-2-yl)urea (PubChem CID 173451617) has the molecular formula C13H28N4O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is methyl N-(dimethylaminomethylidene)carbamate;1-methyl-3-(4-methylpentan-2-yl)urea.
| Compound Name | methyl N-(dimethylaminomethylidene)carbamate;1-methyl-3-(4-methylpentan-2-yl)urea |
|---|---|
| PubChem CID | 173451617 |
| Molecular Formula | C13H28N4O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | methyl N-(dimethylaminomethylidene)carbamate;1-methyl-3-(4-methylpentan-2-yl)urea |
| SMILES | CNC(=O)NC(C)CC(C)C.COC(=O)N=CN(C)C |
| InChI | InChI=1S/C8H18N2O.C5H10N2O2/c1-6(2)5-7(3)10-8(11)9-4;1-7(2)4-6-5(8)9-3/h6-7H,5H2,1-4H3,(H2,9,10,11);4H,1-3H3 |
| InChIKey | BLSVREASOCWUEE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|