C7H12Ca2O9 — CID 173452418
dicalcium;hydride;4-hydroperoxy-4-oxobutane-1,2,3-tricarboxylic acid (PubChem CID 173452418) has the molecular formula C7H12Ca2O9 and a molecular weight of 320.32 g/mol. Its IUPAC name is dicalcium;hydride;4-hydroperoxy-4-oxobutane-1,2,3-tricarboxylic acid.
| Compound Name | dicalcium;hydride;4-hydroperoxy-4-oxobutane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 173452418 |
| Molecular Formula | C7H12Ca2O9 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | dicalcium;hydride;4-hydroperoxy-4-oxobutane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(C(=O)O)C(C(=O)O)C(=O)OO.[Ca+2].[Ca+2].[H-].[H-].[H-].[H-] |
| InChI | InChI=1S/C7H8O9.2Ca.4H/c8-3(9)1-2(5(10)11)4(6(12)13)7(14)16-15;;;;;;/h2,4,15H,1H2,(H,8,9)(H,10,11)(H,12,13);;;;;;/q;2*+2;4*-1 |
| InChIKey | WCRVVWOTVNXWPS-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|