About 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate
1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate (PubChem CID 173452798) has the molecular formula C13H24N4O2S
and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate.
Molecular Properties
| Compound Name | 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate |
| PubChem CID | 173452798 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate |
| SMILES | CNC(=O)NC1=CCCCC1.COC(=S)N=CN(C)C |
| InChI | InChI=1S/C8H14N2O.C5H10N2OS/c1-9-8(11)10-7-5-3-2-4-6-7;1-7(2)4-6-5(9)8-3/h5H,2-4,6H2,1H3,(H2,9,10,11);4H,1-3H3 |
| InChIKey | BBTTYSPFUAIGRX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate?
The IUPAC name of 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate (CID 173452798) is 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate.
What is the SMILES notation for 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate?
The canonical SMILES for 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate is CNC(=O)NC1=CCCCC1.COC(=S)N=CN(C)C.
What is the InChIKey of 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate?
The InChIKey is BBTTYSPFUAIGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O.C5H10N2OS/c1-9-8(11)10-7-5-3-2-4-6-7;1-7(2)4-6-5(9)8-3/h5H,2-4,6H2,1H3,(H2,9,10,11);4H,1-3H3.
What are the key properties of 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate?
1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate has a molecular weight of 300.43 g/mol, XLogP of 1.88, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexen-1-yl)-3-methylurea;O-methyl N-(dimethylaminomethylidene)carbamothioate is sourced from PubChem (CID 173452798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).