C10H7NO6 — CID 173454604
3-(6-nitro-3H-1,2-benzodioxol-5-yl)prop-2-enoic acid (PubChem CID 173454604) has the molecular formula C10H7NO6 and a molecular weight of 237.17 g/mol. Its IUPAC name is 3-(6-nitro-3H-1,2-benzodioxol-5-yl)prop-2-enoic acid.
| Compound Name | 3-(6-nitro-3H-1,2-benzodioxol-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 173454604 |
| Molecular Formula | C10H7NO6 |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 3-(6-nitro-3H-1,2-benzodioxol-5-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc2c(cc1[N+](=O)[O-])OOC2 |
| InChI | InChI=1S/C10H7NO6/c12-10(13)2-1-6-3-7-5-16-17-9(7)4-8(6)11(14)15/h1-4H,5H2,(H,12,13) |
| InChIKey | GIAQWBCRMFTJIV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|