C11H11NO6 — CID 59584488
(E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoic acid (PubChem CID 59584488) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59584488 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | (E)-3-[4,5-bis(hydroxymethyl)-2-nitrophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(CO)c(CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11NO6/c13-5-8-3-7(1-2-11(15)16)10(12(17)18)4-9(8)6-14/h1-4,13-14H,5-6H2,(H,15,16)/b2-1+ |
| InChIKey | CKSMLGQHMLRFAS-OWOJBTEDSA-N |
| XLogP | 0.68 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|