C14H18Cl3NO7 — CID 173457990
2,3-dihydroxybutanedioic acid;(2R)-1,1,1-trichloro-3-(3-ethyl-4-pyridinyl)propan-2-ol (PubChem CID 173457990) has the molecular formula C14H18Cl3NO7 and a molecular weight of 418.66 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(2R)-1,1,1-trichloro-3-(3-ethyl-4-pyridinyl)propan-2-ol.
| Compound Name | 2,3-dihydroxybutanedioic acid;(2R)-1,1,1-trichloro-3-(3-ethyl-4-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 173457990 |
| Molecular Formula | C14H18Cl3NO7 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(2R)-1,1,1-trichloro-3-(3-ethyl-4-pyridinyl)propan-2-ol |
| SMILES | CCc1cnccc1C[C@@H](O)C(Cl)(Cl)Cl.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H12Cl3NO.C4H6O6/c1-2-7-6-14-4-3-8(7)5-9(15)10(11,12)13;5-1(3(7)8)2(6)4(9)10/h3-4,6,9,15H,2,5H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t9-;/m1./s1 |
| InChIKey | IJBAPQZJOAGGQF-SBSPUUFOSA-N |
| XLogP | 0.80 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|