About sodium;(2-aminoethylamino)thiourea;hydride
sodium;(2-aminoethylamino)thiourea;hydride (PubChem CID 173458055) has the molecular formula C3H11N4NaS
and a molecular weight of 158.21 g/mol. Its IUPAC name is sodium;(2-aminoethylamino)thiourea;hydride.
Molecular Properties
| Compound Name | sodium;(2-aminoethylamino)thiourea;hydride |
| PubChem CID | 173458055 |
| Molecular Formula | C3H11N4NaS |
| Molecular Weight | 158.21 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | sodium;(2-aminoethylamino)thiourea;hydride |
| SMILES | NCCNNC(N)=S.[H-].[Na+] |
| InChI | InChI=1S/C3H10N4S.Na.H/c4-1-2-6-7-3(5)8;;/h6H,1-2,4H2,(H3,5,7,8);;/q;+1;-1 |
| InChIKey | WMCGLVRZRTXGGM-UHFFFAOYSA-N |
| XLogP | -4.60 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.21 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;(2-aminoethylamino)thiourea;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;(2-aminoethylamino)thiourea;hydride?
The IUPAC name of sodium;(2-aminoethylamino)thiourea;hydride (CID 173458055) is sodium;(2-aminoethylamino)thiourea;hydride.
What is the SMILES notation for sodium;(2-aminoethylamino)thiourea;hydride?
The canonical SMILES for sodium;(2-aminoethylamino)thiourea;hydride is NCCNNC(N)=S.[H-].[Na+].
What is the InChIKey of sodium;(2-aminoethylamino)thiourea;hydride?
The InChIKey is WMCGLVRZRTXGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N4S.Na.H/c4-1-2-6-7-3(5)8;;/h6H,1-2,4H2,(H3,5,7,8);;/q;+1;-1.
What are the key properties of sodium;(2-aminoethylamino)thiourea;hydride?
sodium;(2-aminoethylamino)thiourea;hydride has a molecular weight of 158.21 g/mol, XLogP of -4.60, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;(2-aminoethylamino)thiourea;hydride is sourced from PubChem (CID 173458055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).