C5H15N5S — CID 174665730
3-amino-1,1-bis(ethylamino)thiourea (PubChem CID 174665730) has the molecular formula C5H15N5S and a molecular weight of 177.28 g/mol. Its IUPAC name is 3-amino-1,1-bis(ethylamino)thiourea.
| Compound Name | 3-amino-1,1-bis(ethylamino)thiourea |
|---|---|
| PubChem CID | 174665730 |
| Molecular Formula | C5H15N5S |
| Molecular Weight | 177.28 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-amino-1,1-bis(ethylamino)thiourea |
| SMILES | CCNN(NCC)C(=S)NN |
| InChI | InChI=1S/C5H15N5S/c1-3-7-10(8-4-2)5(11)9-6/h7-8H,3-4,6H2,1-2H3,(H,9,11) |
| InChIKey | HVJPOEOSRMBGLN-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|