C5H14N4S — CID 174677956
1,1-bis(ethylamino)thiourea (PubChem CID 174677956) has the molecular formula C5H14N4S and a molecular weight of 162.26 g/mol. Its IUPAC name is 1,1-bis(ethylamino)thiourea.
| Compound Name | 1,1-bis(ethylamino)thiourea |
|---|---|
| PubChem CID | 174677956 |
| Molecular Formula | C5H14N4S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,1-bis(ethylamino)thiourea |
| SMILES | CCNN(NCC)C(N)=S |
| InChI | InChI=1S/C5H14N4S/c1-3-7-9(5(6)10)8-4-2/h7-8H,3-4H2,1-2H3,(H2,6,10) |
| InChIKey | CFCBDEMGBVYQDO-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|