C30H46S4 — CID 173459751
8-phenyl-8-(1-phenyl-4-sulfanylbutyl)tetradecane-1,7,14-trithiol (PubChem CID 173459751) has the molecular formula C30H46S4 and a molecular weight of 534.97 g/mol. Its IUPAC name is 8-phenyl-8-(1-phenyl-4-sulfanylbutyl)tetradecane-1,7,14-trithiol.
| Compound Name | 8-phenyl-8-(1-phenyl-4-sulfanylbutyl)tetradecane-1,7,14-trithiol |
|---|---|
| PubChem CID | 173459751 |
| Molecular Formula | C30H46S4 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 8-phenyl-8-(1-phenyl-4-sulfanylbutyl)tetradecane-1,7,14-trithiol |
| SMILES | SCCCCCCC(S)C(CCCCCCS)(c1ccccc1)C(CCCS)c1ccccc1 |
| InChI | InChI=1S/C30H46S4/c31-23-13-3-1-11-21-29(34)30(22-12-2-4-14-24-32,27-18-9-6-10-19-27)28(20-15-25-33)26-16-7-5-8-17-26/h5-10,16-19,28-29,31-34H,1-4,11-15,20-25H2 |
| InChIKey | MGOFKGCVRPEAGR-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|