C10H10Cl2O3S — CID 173463121
3-(2,6-dichlorophenyl)-2-methylprop-2-ene-1-sulfonic acid (PubChem CID 173463121) has the molecular formula C10H10Cl2O3S and a molecular weight of 281.16 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2-methylprop-2-ene-1-sulfonic acid.
| Compound Name | 3-(2,6-dichlorophenyl)-2-methylprop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 173463121 |
| Molecular Formula | C10H10Cl2O3S |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2-methylprop-2-ene-1-sulfonic acid |
| SMILES | CC(=Cc1c(Cl)cccc1Cl)CS(=O)(=O)O |
| InChI | InChI=1S/C10H10Cl2O3S/c1-7(6-16(13,14)15)5-8-9(11)3-2-4-10(8)12/h2-5H,6H2,1H3,(H,13,14,15) |
| InChIKey | JFXXYARLYOEPNE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|