C11H12Cl2O — CID 79335321
2-[(2,6-dichlorophenyl)methylidene]butan-1-ol (PubChem CID 79335321) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol.
| Compound Name | 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol |
|---|---|
| PubChem CID | 79335321 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol |
| SMILES | CCC(=Cc1c(Cl)cccc1Cl)CO |
| InChI | InChI=1S/C11H12Cl2O/c1-2-8(7-14)6-9-10(12)4-3-5-11(9)13/h3-6,14H,2,7H2,1H3 |
| InChIKey | OWYYASXAWSFMMN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |