About 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol
2-[(2,6-dichlorophenyl)methylidene]butan-1-ol (PubChem CID 79335321) has the molecular formula C11H12Cl2O
and a molecular weight of 231.12 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol.
Molecular Properties
| Compound Name | 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol |
| PubChem CID | 79335321 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol |
| SMILES | CCC(=Cc1c(Cl)cccc1Cl)CO |
| InChI | InChI=1S/C11H12Cl2O/c1-2-8(7-14)6-9-10(12)4-3-5-11(9)13/h3-6,14H,2,7H2,1H3 |
| InChIKey | OWYYASXAWSFMMN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol?
The IUPAC name of 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol (CID 79335321) is 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol.
What is the SMILES notation for 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol?
The canonical SMILES for 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol is CCC(=Cc1c(Cl)cccc1Cl)CO.
What is the InChIKey of 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol?
The InChIKey is OWYYASXAWSFMMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O/c1-2-8(7-14)6-9-10(12)4-3-5-11(9)13/h3-6,14H,2,7H2,1H3.
What are the key properties of 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol?
2-[(2,6-dichlorophenyl)methylidene]butan-1-ol has a molecular weight of 231.12 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichlorophenyl)methylidene]butan-1-ol is sourced from PubChem (CID 79335321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).