C18H29NO6Si — CID 173464163
2-[N-(1-diethoxysilylbutyl)anilino]butanedioic acid (PubChem CID 173464163) has the molecular formula C18H29NO6Si and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-[N-(1-diethoxysilylbutyl)anilino]butanedioic acid.
| Compound Name | 2-[N-(1-diethoxysilylbutyl)anilino]butanedioic acid |
|---|---|
| PubChem CID | 173464163 |
| Molecular Formula | C18H29NO6Si |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[N-(1-diethoxysilylbutyl)anilino]butanedioic acid |
| SMILES | CCCC(N(c1ccccc1)C(CC(=O)O)C(=O)O)[SiH](OCC)OCC |
| InChI | InChI=1S/C18H29NO6Si/c1-4-10-16(26(24-5-2)25-6-3)19(14-11-8-7-9-12-14)15(18(22)23)13-17(20)21/h7-9,11-12,15-16,26H,4-6,10,13H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | YQOFROZYUGUMEK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|