C21H25NO5 — CID 70088938
(2S)-2-(N-[(R)-2-carboxyethoxy(phenyl)methyl]anilino)pentanoic acid (PubChem CID 70088938) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (2S)-2-(N-[(R)-2-carboxyethoxy(phenyl)methyl]anilino)pentanoic acid.
| Compound Name | (2S)-2-(N-[(R)-2-carboxyethoxy(phenyl)methyl]anilino)pentanoic acid |
|---|---|
| PubChem CID | 70088938 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2S)-2-(N-[(R)-2-carboxyethoxy(phenyl)methyl]anilino)pentanoic acid |
| SMILES | CCC[C@@H](C(=O)O)N(c1ccccc1)[C@H](OCCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H25NO5/c1-2-9-18(21(25)26)22(17-12-7-4-8-13-17)20(27-15-14-19(23)24)16-10-5-3-6-11-16/h3-8,10-13,18,20H,2,9,14-15H2,1H3,(H,23,24)(H,25,26)/t18-,20+/m0/s1 |
| InChIKey | QHDHNZDDNJHXRJ-AZUAARDMSA-N |
| XLogP | 3.94 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|