About 1-butoxy-N,N-dimethyl-1-phenylmethanamine
1-butoxy-N,N-dimethyl-1-phenylmethanamine (PubChem CID 11183372) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-butoxy-N,N-dimethyl-1-phenylmethanamine.
Molecular Properties
| Compound Name | 1-butoxy-N,N-dimethyl-1-phenylmethanamine |
| PubChem CID | 11183372 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-butoxy-N,N-dimethyl-1-phenylmethanamine |
| SMILES | CCCCOC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C13H21NO/c1-4-5-11-15-13(14(2)3)12-9-7-6-8-10-12/h6-10,13H,4-5,11H2,1-3H3 |
| InChIKey | ANIPOZYTAPDGJL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-N,N-dimethyl-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-N,N-dimethyl-1-phenylmethanamine?
The IUPAC name of 1-butoxy-N,N-dimethyl-1-phenylmethanamine (CID 11183372) is 1-butoxy-N,N-dimethyl-1-phenylmethanamine.
What is the SMILES notation for 1-butoxy-N,N-dimethyl-1-phenylmethanamine?
The canonical SMILES for 1-butoxy-N,N-dimethyl-1-phenylmethanamine is CCCCOC(c1ccccc1)N(C)C.
What is the InChIKey of 1-butoxy-N,N-dimethyl-1-phenylmethanamine?
The InChIKey is ANIPOZYTAPDGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO/c1-4-5-11-15-13(14(2)3)12-9-7-6-8-10-12/h6-10,13H,4-5,11H2,1-3H3.
What are the key properties of 1-butoxy-N,N-dimethyl-1-phenylmethanamine?
1-butoxy-N,N-dimethyl-1-phenylmethanamine has a molecular weight of 207.32 g/mol, XLogP of 3.06, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-N,N-dimethyl-1-phenylmethanamine is sourced from PubChem (CID 11183372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).