C13H17NO5S — CID 82324463
2-[2-carboxyethyl(thiophene-2-carbonyl)amino]pentanoic acid (PubChem CID 82324463) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[2-carboxyethyl(thiophene-2-carbonyl)amino]pentanoic acid.
| Compound Name | 2-[2-carboxyethyl(thiophene-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 82324463 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[2-carboxyethyl(thiophene-2-carbonyl)amino]pentanoic acid |
| SMILES | CCCC(C(=O)O)N(CCC(=O)O)C(=O)c1cccs1 |
| InChI | InChI=1S/C13H17NO5S/c1-2-4-9(13(18)19)14(7-6-11(15)16)12(17)10-5-3-8-20-10/h3,5,8-9H,2,4,6-7H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | AAFDQZQMSBXFEW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |