C14H19ClN2O8S — CID 173464461
(E)-5-[(2-chloroacetyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)oxy-3,3-dimethyl-1-oxohex-4-ene-2-sulfonic acid (PubChem CID 173464461) has the molecular formula C14H19ClN2O8S and a molecular weight of 410.83 g/mol. Its IUPAC name is (E)-5-[(2-chloroacetyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)oxy-3,3-dimethyl-1-oxohex-4-ene-2-sulfonic acid.
| Compound Name | (E)-5-[(2-chloroacetyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)oxy-3,3-dimethyl-1-oxohex-4-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 173464461 |
| Molecular Formula | C14H19ClN2O8S |
| Molecular Weight | 410.83 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | (E)-5-[(2-chloroacetyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)oxy-3,3-dimethyl-1-oxohex-4-ene-2-sulfonic acid |
| SMILES | C/C(=C\C(C)(C)C(C(=O)ON1C(=O)CCC1=O)S(=O)(=O)O)NC(=O)CCl |
| InChI | InChI=1S/C14H19ClN2O8S/c1-8(16-9(18)7-15)6-14(2,3)12(26(22,23)24)13(21)25-17-10(19)4-5-11(17)20/h6,12H,4-5,7H2,1-3H3,(H,16,18)(H,22,23,24)/b8-6+ |
| InChIKey | XTZWHNBRDOKUPW-SOFGYWHQSA-N |
| XLogP | 0.14 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.83 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|