C23H23F3N6O5 — CID 173464909
[(2S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxolan-2-yl]methyl formate (PubChem CID 173464909) has the molecular formula C23H23F3N6O5 and a molecular weight of 520.47 g/mol. Its IUPAC name is [(2S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxolan-2-yl]methyl formate.
| Compound Name | [(2S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxolan-2-yl]methyl formate |
|---|---|
| PubChem CID | 173464909 |
| Molecular Formula | C23H23F3N6O5 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [(2S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxolan-2-yl]methyl formate |
| SMILES | CC[C@]1(COC=O)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](NC(=O)C(F)(F)F)C1C |
| InChI | InChI=1S/C23H23F3N6O5/c1-3-22(9-36-12-33)13(2)15(30-21(35)23(24,25)26)20(37-22)32-11-29-16-17(27-10-28-18(16)32)31-19(34)14-7-5-4-6-8-14/h4-8,10-13,15,20H,3,9H2,1-2H3,(H,30,35)(H,27,28,31,34)/t13?,15-,20+,22+/m0/s1 |
| InChIKey | ROYKOUOYJWVNEO-RARLNWRISA-N |
| XLogP | 2.61 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|