C30H30N2O5 — CID 173465073
5-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]peroxyethenyl]phenyl]peroxybenzene-1,3-diamine (PubChem CID 173465073) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 5-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]peroxyethenyl]phenyl]peroxybenzene-1,3-diamine.
| Compound Name | 5-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]peroxyethenyl]phenyl]peroxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 173465073 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 5-[4-[(E)-2-[4-(4-butoxyphenyl)phenyl]peroxyethenyl]phenyl]peroxybenzene-1,3-diamine |
| SMILES | CCCCOc1ccc(-c2ccc(OO/C=C/c3ccc(OOc4cc(N)cc(N)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O5/c1-2-3-17-33-27-12-6-23(7-13-27)24-8-14-28(15-9-24)35-34-18-16-22-4-10-29(11-5-22)36-37-30-20-25(31)19-26(32)21-30/h4-16,18-21H,2-3,17,31-32H2,1H3/b18-16+ |
| InChIKey | NHYZOVNQSXSUFT-FBMGVBCBSA-N |
| XLogP | 7.05 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|