C14H25N3 — CID 173466761
(1S,2R,9R,10S)-7,8,15-triazatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 173466761) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (1S,2R,9R,10S)-7,8,15-triazatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (1S,2R,9R,10S)-7,8,15-triazatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 173466761 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (1S,2R,9R,10S)-7,8,15-triazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | C1CCN2N[C@@H]3C[C@@H](CN4CCCC[C@@H]34)[C@H]2C1 |
| InChI | InChI=1S/C14H25N3/c1-3-7-16-10-11-9-12(14(16)6-1)15-17-8-4-2-5-13(11)17/h11-15H,1-10H2/t11-,12+,13+,14-/m0/s1 |
| InChIKey | QHARSHPFGAZDPB-DGAVXFQQSA-N |
| XLogP | 1.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |