C18H29N3O5 — CID 173468049
methyl (4R,6R,7Z,16S,18R)-18-hydroxy-13-methyl-2-oxo-14-oxa-1,3,13-triazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate (PubChem CID 173468049) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl (4R,6R,7Z,16S,18R)-18-hydroxy-13-methyl-2-oxo-14-oxa-1,3,13-triazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate.
| Compound Name | methyl (4R,6R,7Z,16S,18R)-18-hydroxy-13-methyl-2-oxo-14-oxa-1,3,13-triazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
|---|---|
| PubChem CID | 173468049 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | methyl (4R,6R,7Z,16S,18R)-18-hydroxy-13-methyl-2-oxo-14-oxa-1,3,13-triazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@@H]1/C=C\CCCCN(C)OC[C@@H]1C[C@@H](O)CN1C(=O)N2 |
| InChI | InChI=1S/C18H29N3O5/c1-20-8-6-4-3-5-7-13-10-18(13,16(23)25-2)19-17(24)21-11-15(22)9-14(21)12-26-20/h5,7,13-15,22H,3-4,6,8-12H2,1-2H3,(H,19,24)/b7-5-/t13-,14-,15+,18+/m0/s1 |
| InChIKey | OKMCELGEQJYCEZ-XJOPAKOUSA-N |
| XLogP | 0.67 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|