About CID 173468078
CID 173468078 (PubChem CID 173468078) has the molecular formula C11H20BN
and a molecular weight of 177.10 g/mol.
Molecular Properties
| Compound Name | CID 173468078 |
| PubChem CID | 173468078 |
| Molecular Formula | C11H20BN |
| Molecular Weight | 177.10 g/mol |
| Exact Mass | 177.17 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)/C=C(C)\N=C\C(C)(C)C |
| InChI | InChI=1S/C11H20BN/c1-9(7-11(5,6)12)13-8-10(2,3)4/h7-8H,1-6H3/b9-7-,13-8+ |
| InChIKey | KOFDAXDXBDFISL-OKFFXAGVSA-N |
| XLogP | 3.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.10 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 173468078 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173468078?
The IUPAC name of CID 173468078 (CID 173468078) is not available.
What is the SMILES notation for CID 173468078?
The canonical SMILES for CID 173468078 is [B]C(C)(C)/C=C(C)\N=C\C(C)(C)C.
What is the InChIKey of CID 173468078?
The InChIKey is KOFDAXDXBDFISL-OKFFXAGVSA-N. The full InChI is InChI=1S/C11H20BN/c1-9(7-11(5,6)12)13-8-10(2,3)4/h7-8H,1-6H3/b9-7-,13-8+.
What are the key properties of CID 173468078?
CID 173468078 has a molecular weight of 177.10 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173468078 is sourced from PubChem (CID 173468078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).