C8H14N2O3 — CID 166117446
(2Z)-2-(2,2-dimethylpropylideneamino)-2-methoxyiminoacetic acid (PubChem CID 166117446) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2Z)-2-(2,2-dimethylpropylideneamino)-2-methoxyiminoacetic acid.
| Compound Name | (2Z)-2-(2,2-dimethylpropylideneamino)-2-methoxyiminoacetic acid |
|---|---|
| PubChem CID | 166117446 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (2Z)-2-(2,2-dimethylpropylideneamino)-2-methoxyiminoacetic acid |
| SMILES | CO/N=C(\N=C\C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C8H14N2O3/c1-8(2,3)5-9-6(7(11)12)10-13-4/h5H,1-4H3,(H,11,12)/b9-5+,10-6- |
| InChIKey | MBVABFJUSFRNEY-POQLCMLLSA-N |
| XLogP | 1.15 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|