C23H28NO+ — CID 173469906
ethyl-dimethyl-[(1S)-3-naphthalen-1-yloxy-1-phenylpropyl]azanium (PubChem CID 173469906) has the molecular formula C23H28NO+ and a molecular weight of 334.48 g/mol. Its IUPAC name is ethyl-dimethyl-[(1S)-3-naphthalen-1-yloxy-1-phenylpropyl]azanium.
| Compound Name | ethyl-dimethyl-[(1S)-3-naphthalen-1-yloxy-1-phenylpropyl]azanium |
|---|---|
| PubChem CID | 173469906 |
| Molecular Formula | C23H28NO+ |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | ethyl-dimethyl-[(1S)-3-naphthalen-1-yloxy-1-phenylpropyl]azanium |
| SMILES | CC[N+](C)(C)[C@@H](CCOc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C23H28NO/c1-4-24(2,3)22(20-12-6-5-7-13-20)17-18-25-23-16-10-14-19-11-8-9-15-21(19)23/h5-16,22H,4,17-18H2,1-3H3/q+1/t22-/m0/s1 |
| InChIKey | GNQVGDURUKBYEY-QFIPXVFZSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|