C29H33NO5P+ — CID 87158820
dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)-(2-phenyl-1-phosphonooxyethyl)azanium (PubChem CID 87158820) has the molecular formula C29H33NO5P+ and a molecular weight of 506.56 g/mol. Its IUPAC name is dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)-(2-phenyl-1-phosphonooxyethyl)azanium.
| Compound Name | dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)-(2-phenyl-1-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 87158820 |
| Molecular Formula | C29H33NO5P+ |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)-(2-phenyl-1-phosphonooxyethyl)azanium |
| SMILES | C[N+](C)(C(Cc1ccccc1)OP(=O)(O)O)C(CCOc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C29H32NO5P/c1-30(2,29(35-36(31,32)33)22-23-12-5-3-6-13-23)27(25-15-7-4-8-16-25)20-21-34-28-19-11-17-24-14-9-10-18-26(24)28/h3-19,27,29H,20-22H2,1-2H3,(H-,31,32,33)/p+1 |
| InChIKey | ROTHFEUBRKFLFU-UHFFFAOYSA-O |
| XLogP | 6.10 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|