C22H26NO5P — CID 87158886
[dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)azaniumyl]methyl hydrogen phosphate (PubChem CID 87158886) has the molecular formula C22H26NO5P and a molecular weight of 415.43 g/mol. Its IUPAC name is [dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)azaniumyl]methyl hydrogen phosphate.
| Compound Name | [dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)azaniumyl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 87158886 |
| Molecular Formula | C22H26NO5P |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [dimethyl-(3-naphthalen-1-yloxy-1-phenylpropyl)azaniumyl]methyl hydrogen phosphate |
| SMILES | C[N+](C)(COP(=O)([O-])O)C(CCOc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H26NO5P/c1-23(2,17-28-29(24,25)26)21(19-10-4-3-5-11-19)15-16-27-22-14-8-12-18-9-6-7-13-20(18)22/h3-14,21H,15-17H2,1-2H3,(H-,24,25,26) |
| InChIKey | VQTGSMYRSQRZLB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|