C19H21NO5S — CID 174609080
N-naphthalen-1-yloxy-1-phenylpropan-2-amine;sulfuric acid (PubChem CID 174609080) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-naphthalen-1-yloxy-1-phenylpropan-2-amine;sulfuric acid.
| Compound Name | N-naphthalen-1-yloxy-1-phenylpropan-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 174609080 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-naphthalen-1-yloxy-1-phenylpropan-2-amine;sulfuric acid |
| SMILES | CC(Cc1ccccc1)NOc1cccc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C19H19NO.H2O4S/c1-15(14-16-8-3-2-4-9-16)20-21-19-13-7-11-17-10-5-6-12-18(17)19;1-5(2,3)4/h2-13,15,20H,14H2,1H3;(H2,1,2,3,4) |
| InChIKey | HYNOCDJBVKKMQY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|