About sodium;hydride;3-nitro-3-oxopropanal
sodium;hydride;3-nitro-3-oxopropanal (PubChem CID 173472789) has the molecular formula C3H4NNaO4
and a molecular weight of 141.06 g/mol. Its IUPAC name is sodium;hydride;3-nitro-3-oxopropanal.
Molecular Properties
| Compound Name | sodium;hydride;3-nitro-3-oxopropanal |
| PubChem CID | 173472789 |
| Molecular Formula | C3H4NNaO4 |
| Molecular Weight | 141.06 g/mol |
| Exact Mass | 141.00 |
| IUPAC Name | sodium;hydride;3-nitro-3-oxopropanal |
| SMILES | O=CCC(=O)[N+](=O)[O-].[H-].[Na+] |
| InChI | InChI=1S/C3H3NO4.Na.H/c5-2-1-3(6)4(7)8;;/h2H,1H2;;/q;+1;-1 |
| InChIKey | UDGBCXYVBAUDRB-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.06 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-nitro-3-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-nitro-3-oxopropanal?
The IUPAC name of sodium;hydride;3-nitro-3-oxopropanal (CID 173472789) is sodium;hydride;3-nitro-3-oxopropanal.
What is the SMILES notation for sodium;hydride;3-nitro-3-oxopropanal?
The canonical SMILES for sodium;hydride;3-nitro-3-oxopropanal is O=CCC(=O)[N+](=O)[O-].[H-].[Na+].
What is the InChIKey of sodium;hydride;3-nitro-3-oxopropanal?
The InChIKey is UDGBCXYVBAUDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO4.Na.H/c5-2-1-3(6)4(7)8;;/h2H,1H2;;/q;+1;-1.
What are the key properties of sodium;hydride;3-nitro-3-oxopropanal?
sodium;hydride;3-nitro-3-oxopropanal has a molecular weight of 141.06 g/mol, XLogP of -3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-nitro-3-oxopropanal is sourced from PubChem (CID 173472789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).