About sodium 1-nitropropane-1,3-diol
sodium 1-nitropropane-1,3-diol (PubChem CID 23690969) has the molecular formula C3H7NNaO4+
and a molecular weight of 144.08 g/mol. Its IUPAC name is sodium 1-nitropropane-1,3-diol.
Molecular Properties
| Compound Name | sodium 1-nitropropane-1,3-diol |
| PubChem CID | 23690969 |
| Molecular Formula | C3H7NNaO4+ |
| Molecular Weight | 144.08 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | sodium 1-nitropropane-1,3-diol |
| SMILES | O=[N+]([O-])C(O)CCO.[Na+] |
| InChI | InChI=1S/C3H7NO4.Na/c5-2-1-3(6)4(7)8;/h3,5-6H,1-2H2;/q;+1 |
| InChIKey | RQZSCPLWYFCYOS-UHFFFAOYSA-N |
| XLogP | -4.03 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.08 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-nitropropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-nitropropane-1,3-diol?
The IUPAC name of sodium 1-nitropropane-1,3-diol (CID 23690969) is sodium 1-nitropropane-1,3-diol.
What is the SMILES notation for sodium 1-nitropropane-1,3-diol?
The canonical SMILES for sodium 1-nitropropane-1,3-diol is O=[N+]([O-])C(O)CCO.[Na+].
What is the InChIKey of sodium 1-nitropropane-1,3-diol?
The InChIKey is RQZSCPLWYFCYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO4.Na/c5-2-1-3(6)4(7)8;/h3,5-6H,1-2H2;/q;+1.
What are the key properties of sodium 1-nitropropane-1,3-diol?
sodium 1-nitropropane-1,3-diol has a molecular weight of 144.08 g/mol, XLogP of -4.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-nitropropane-1,3-diol is sourced from PubChem (CID 23690969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).