C13H25ClN2O3S — CID 173480129
N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]-3-chloropropane-1-sulfonamide (PubChem CID 173480129) has the molecular formula C13H25ClN2O3S and a molecular weight of 324.87 g/mol. Its IUPAC name is N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]-3-chloropropane-1-sulfonamide.
| Compound Name | N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]-3-chloropropane-1-sulfonamide |
|---|---|
| PubChem CID | 173480129 |
| Molecular Formula | C13H25ClN2O3S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]-3-chloropropane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCC(O)CN1[C@@H]2CCC[C@H]1CC2 |
| InChI | InChI=1S/C13H25ClN2O3S/c14-7-2-8-20(18,19)15-9-13(17)10-16-11-3-1-4-12(16)6-5-11/h11-13,15,17H,1-10H2/t11-,12+,13? |
| InChIKey | RQCCHVASIBMKHO-FUNVUKJBSA-N |
| XLogP | 0.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|