C15H29N5 — CID 173483704
(3S)-1-[C-[(Z)-2-aminoethenyl]-N-[1-(2,2-dimethylpropylamino)ethenyl]carbonimidoyl]-N-methylpyrrolidin-3-amine (PubChem CID 173483704) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is (3S)-1-[C-[(Z)-2-aminoethenyl]-N-[1-(2,2-dimethylpropylamino)ethenyl]carbonimidoyl]-N-methylpyrrolidin-3-amine.
| Compound Name | (3S)-1-[C-[(Z)-2-aminoethenyl]-N-[1-(2,2-dimethylpropylamino)ethenyl]carbonimidoyl]-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 173483704 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | (3S)-1-[C-[(Z)-2-aminoethenyl]-N-[1-(2,2-dimethylpropylamino)ethenyl]carbonimidoyl]-N-methylpyrrolidin-3-amine |
| SMILES | C=C(N=C(/C=C\N)N1CC[C@H](NC)C1)NCC(C)(C)C |
| InChI | InChI=1S/C15H29N5/c1-12(18-11-15(2,3)4)19-14(6-8-16)20-9-7-13(10-20)17-5/h6,8,13,17-18H,1,7,9-11,16H2,2-5H3/b8-6-,19-14?/t13-/m0/s1 |
| InChIKey | QPFNHZKCHOMINB-WBYXKPEASA-N |
| XLogP | 1.26 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|