C3H6N4O2 — CID 173484324
3-imino-1-nitroprop-1-ene-1,2-diamine (PubChem CID 173484324) has the molecular formula C3H6N4O2 and a molecular weight of 130.11 g/mol. Its IUPAC name is 3-imino-1-nitroprop-1-ene-1,2-diamine.
| Compound Name | 3-imino-1-nitroprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 173484324 |
| Molecular Formula | C3H6N4O2 |
| Molecular Weight | 130.11 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | 3-imino-1-nitroprop-1-ene-1,2-diamine |
| SMILES | [H]/N=C/C(N)=C(N)[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N4O2/c4-1-2(5)3(6)7(8)9/h1,4H,5-6H2/b3-2?,4-1+ |
| InChIKey | KQNZATCUNFPPMJ-FDEIINACSA-N |
| XLogP | -1.00 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.11 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|