About 1-nitroethanimine
1-nitroethanimine (PubChem CID 54158786) has the molecular formula C2H4N2O2
and a molecular weight of 88.07 g/mol. Its IUPAC name is 1-nitroethanimine.
Molecular Properties
| Compound Name | 1-nitroethanimine |
| PubChem CID | 54158786 |
| Molecular Formula | C2H4N2O2 |
| Molecular Weight | 88.07 g/mol |
| Exact Mass | 88.03 |
| IUPAC Name | 1-nitroethanimine |
| SMILES | [H]/N=C(\C)[N+](=O)[O-] |
| InChI | InChI=1S/C2H4N2O2/c1-2(3)4(5)6/h3H,1H3/b3-2+ |
| InChIKey | OMYMZESRLIGSFF-NSCUHMNNSA-N |
| XLogP | 0.26 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.07 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitroethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitroethanimine?
The IUPAC name of 1-nitroethanimine (CID 54158786) is 1-nitroethanimine.
What is the SMILES notation for 1-nitroethanimine?
The canonical SMILES for 1-nitroethanimine is [H]/N=C(\C)[N+](=O)[O-].
What is the InChIKey of 1-nitroethanimine?
The InChIKey is OMYMZESRLIGSFF-NSCUHMNNSA-N. The full InChI is InChI=1S/C2H4N2O2/c1-2(3)4(5)6/h3H,1H3/b3-2+.
What are the key properties of 1-nitroethanimine?
1-nitroethanimine has a molecular weight of 88.07 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitroethanimine is sourced from PubChem (CID 54158786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).