C15H19BrF3NO3S — CID 173487315
[[(2R)-2-(5-bromo-2-fluorophenyl)-1,1-difluoro-4-methoxy-4-oxobutan-2-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 173487315) has the molecular formula C15H19BrF3NO3S and a molecular weight of 430.29 g/mol. Its IUPAC name is [[(2R)-2-(5-bromo-2-fluorophenyl)-1,1-difluoro-4-methoxy-4-oxobutan-2-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2R)-2-(5-bromo-2-fluorophenyl)-1,1-difluoro-4-methoxy-4-oxobutan-2-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 173487315 |
| Molecular Formula | C15H19BrF3NO3S |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | [[(2R)-2-(5-bromo-2-fluorophenyl)-1,1-difluoro-4-methoxy-4-oxobutan-2-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | COC(=O)C[C@@](N[S+]([O-])C(C)(C)C)(c1cc(Br)ccc1F)C(F)F |
| InChI | InChI=1S/C15H19BrF3NO3S/c1-14(2,3)24(22)20-15(13(18)19,8-12(21)23-4)10-7-9(16)5-6-11(10)17/h5-7,13,20H,8H2,1-4H3/t15-,24?/m1/s1 |
| InChIKey | BPKUGNRVMNJNNP-GZAIGYLVSA-N |
| XLogP | 3.66 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|