C32H36ClN2O8S2+ — CID 173497106
4-[2-[2-[[5-chloro-3-(3-sulfopropyl)-3a,7a-dihydro-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-2-sulfonic acid (PubChem CID 173497106) has the molecular formula C32H36ClN2O8S2+ and a molecular weight of 676.23 g/mol. Its IUPAC name is 4-[2-[2-[[5-chloro-3-(3-sulfopropyl)-3a,7a-dihydro-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-2-sulfonic acid.
| Compound Name | 4-[2-[2-[[5-chloro-3-(3-sulfopropyl)-3a,7a-dihydro-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 173497106 |
| Molecular Formula | C32H36ClN2O8S2+ |
| Molecular Weight | 676.23 g/mol |
| Exact Mass | 675.16 |
| IUPAC Name | 4-[2-[2-[[5-chloro-3-(3-sulfopropyl)-3a,7a-dihydro-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-5-phenyl-1,3-benzoxazol-3-ium-3-yl]butane-2-sulfonic acid |
| SMILES | CCC(=Cc1oc2ccc(-c3ccccc3)cc2[n+]1CCC(C)S(=O)(=O)O)C=C1OC2C=CC(Cl)=CC2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C32H35ClN2O8S2/c1-3-23(18-31-34(15-7-17-44(36,37)38)28-21-26(33)11-13-30(28)43-31)19-32-35(16-14-22(2)45(39,40)41)27-20-25(10-12-29(27)42-32)24-8-5-4-6-9-24/h4-6,8-13,18-22,28,30H,3,7,14-17H2,1-2H3,(H-,36,37,38,39,40,41)/p+1 |
| InChIKey | LPVSAQGHLHSWBJ-UHFFFAOYSA-O |
| XLogP | 5.73 |
| TPSA | 138.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.23 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|