C20H22ClN5O5 — CID 173499297
[(2R,3S,4S)-5-(6-aminopurin-9-yl)-3-[(4-chlorophenyl)-hydroxymethoxy]-4-methyloxolan-2-yl]methyl acetate (PubChem CID 173499297) has the molecular formula C20H22ClN5O5 and a molecular weight of 447.88 g/mol. Its IUPAC name is [(2R,3S,4S)-5-(6-aminopurin-9-yl)-3-[(4-chlorophenyl)-hydroxymethoxy]-4-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-5-(6-aminopurin-9-yl)-3-[(4-chlorophenyl)-hydroxymethoxy]-4-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 173499297 |
| Molecular Formula | C20H22ClN5O5 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | [(2R,3S,4S)-5-(6-aminopurin-9-yl)-3-[(4-chlorophenyl)-hydroxymethoxy]-4-methyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(n2cnc3c(N)ncnc32)[C@@H](C)[C@@H]1OC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN5O5/c1-10-16(31-20(28)12-3-5-13(21)6-4-12)14(7-29-11(2)27)30-19(10)26-9-25-15-17(22)23-8-24-18(15)26/h3-6,8-10,14,16,19-20,28H,7H2,1-2H3,(H2,22,23,24)/t10-,14+,16-,19?,20?/m0/s1 |
| InChIKey | BAGNZZTUOKJMNV-PSXZHMJCSA-N |
| XLogP | 2.23 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|