C18H16ClN5O — CID 173499394
4-amino-1-[5-(3-chloroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-iminopent-3-en-1-one (PubChem CID 173499394) has the molecular formula C18H16ClN5O and a molecular weight of 353.81 g/mol. Its IUPAC name is 4-amino-1-[5-(3-chloroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-iminopent-3-en-1-one.
| Compound Name | 4-amino-1-[5-(3-chloroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-iminopent-3-en-1-one |
|---|---|
| PubChem CID | 173499394 |
| Molecular Formula | C18H16ClN5O |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-amino-1-[5-(3-chloroanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-iminopent-3-en-1-one |
| SMILES | [H]/N=C(\C=C(C)N)C(=O)c1c[nH]c2ncc(Nc3cccc(Cl)c3)cc12 |
| InChI | InChI=1S/C18H16ClN5O/c1-10(20)5-16(21)17(25)15-9-23-18-14(15)7-13(8-22-18)24-12-4-2-3-11(19)6-12/h2-9,21,24H,20H2,1H3,(H,22,23)/b10-5?,21-16+ |
| InChIKey | SSRWDCQLBFNSAP-ATBOJULDSA-N |
| XLogP | 4.02 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|