C26H26N4O5S — CID 17353928
N-[4-[[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]carbamoyl]phenyl]-2-methylbenzamide (PubChem CID 17353928) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[4-[[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]carbamoyl]phenyl]-2-methylbenzamide.
| Compound Name | N-[4-[[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]carbamoyl]phenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 17353928 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | N-[4-[[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]carbamoyl]phenyl]-2-methylbenzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)c3ccccc3C)cc2)cc1 |
| InChI | InChI=1S/C26H26N4O5S/c1-17-5-3-4-6-22(17)25(33)27-20-11-7-19(8-12-20)24(32)29-30-26(36)28-23(31)18-9-13-21(14-10-18)35-16-15-34-2/h3-14H,15-16H2,1-2H3,(H,27,33)(H,29,32)(H2,28,30,31,36) |
| InChIKey | WHHJKRVCFUAXLO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|