C22H24N4O5S — CID 4502833
ethyl 4-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioylamino]-4-oxobutanoate (PubChem CID 4502833) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is ethyl 4-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4502833 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | ethyl 4-[[[4-[(2-methylbenzoyl)amino]benzoyl]amino]carbamothioylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NC(=S)NNC(=O)c1ccc(NC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H24N4O5S/c1-3-31-19(28)13-12-18(27)24-22(32)26-25-20(29)15-8-10-16(11-9-15)23-21(30)17-7-5-4-6-14(17)2/h4-11H,3,12-13H2,1-2H3,(H,23,30)(H,25,29)(H2,24,26,27,32) |
| InChIKey | WFZDFXYGHFWBTH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|