C16H10N4O3S — CID 17361042
2-[(E)-1-cyanoprop-1-en-2-yl]-1,3-dioxo-N-(1,3-thiazol-2-yl)isoindole-5-carboxamide (PubChem CID 17361042) has the molecular formula C16H10N4O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 2-[(E)-1-cyanoprop-1-en-2-yl]-1,3-dioxo-N-(1,3-thiazol-2-yl)isoindole-5-carboxamide.
| Compound Name | 2-[(E)-1-cyanoprop-1-en-2-yl]-1,3-dioxo-N-(1,3-thiazol-2-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361042 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-[(E)-1-cyanoprop-1-en-2-yl]-1,3-dioxo-N-(1,3-thiazol-2-yl)isoindole-5-carboxamide |
| SMILES | C/C(=C\C#N)N1C(=O)c2ccc(C(=O)Nc3nccs3)cc2C1=O |
| InChI | InChI=1S/C16H10N4O3S/c1-9(4-5-17)20-14(22)11-3-2-10(8-12(11)15(20)23)13(21)19-16-18-6-7-24-16/h2-4,6-8H,1H3,(H,18,19,21)/b9-4+ |
| InChIKey | YTDLXLBEMDVISH-RUDMXATFSA-N |
| XLogP | 2.42 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|