C24H23N3O7 — CID 17367825
N-[(9-ethylcarbazol-3-yl)methyl]-2-methoxy-5-nitroaniline;oxalic acid (PubChem CID 17367825) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is N-[(9-ethylcarbazol-3-yl)methyl]-2-methoxy-5-nitroaniline;oxalic acid.
| Compound Name | N-[(9-ethylcarbazol-3-yl)methyl]-2-methoxy-5-nitroaniline;oxalic acid |
|---|---|
| PubChem CID | 17367825 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[(9-ethylcarbazol-3-yl)methyl]-2-methoxy-5-nitroaniline;oxalic acid |
| SMILES | CCn1c2ccccc2c2cc(CNc3cc([N+](=O)[O-])ccc3OC)ccc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H21N3O3.C2H2O4/c1-3-24-20-7-5-4-6-17(20)18-12-15(8-10-21(18)24)14-23-19-13-16(25(26)27)9-11-22(19)28-2;3-1(4)2(5)6/h4-13,23H,3,14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | KHILCKQRLGEBCD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 143.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|