C12H8Cl2N4O2 — CID 17368193
1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole-4-carbonitrile (PubChem CID 17368193) has the molecular formula C12H8Cl2N4O2 and a molecular weight of 311.13 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole-4-carbonitrile.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 17368193 |
| Molecular Formula | C12H8Cl2N4O2 |
| Molecular Weight | 311.13 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-5-methyl-3-nitropyrazole-4-carbonitrile |
| SMILES | Cc1c(C#N)c([N+](=O)[O-])nn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl2N4O2/c1-7-10(5-15)12(18(19)20)16-17(7)6-8-2-3-9(13)4-11(8)14/h2-4H,6H2,1H3 |
| InChIKey | DPNGEQMMTAHBSF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|