C29H39N3O3 — CID 17368557
4-decoxy-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylbenzamide (PubChem CID 17368557) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 4-decoxy-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylbenzamide.
| Compound Name | 4-decoxy-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 17368557 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 4-decoxy-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N-methylbenzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)N(C)c2c(C)n(C)n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C29H39N3O3/c1-5-6-7-8-9-10-11-15-22-35-26-20-18-24(19-21-26)28(33)30(3)27-23(2)31(4)32(29(27)34)25-16-13-12-14-17-25/h12-14,16-21H,5-11,15,22H2,1-4H3 |
| InChIKey | CXAMLGPICYLWFM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|