C13H10F2N4OS — CID 17373384
1-(2,4-difluorophenyl)-3-(pyridine-2-carbonylamino)thiourea (PubChem CID 17373384) has the molecular formula C13H10F2N4OS and a molecular weight of 308.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(pyridine-2-carbonylamino)thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(pyridine-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 17373384 |
| Molecular Formula | C13H10F2N4OS |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(pyridine-2-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(F)cc1F)c1ccccn1 |
| InChI | InChI=1S/C13H10F2N4OS/c14-8-4-5-10(9(15)7-8)17-13(21)19-18-12(20)11-3-1-2-6-16-11/h1-7H,(H,18,20)(H2,17,19,21) |
| InChIKey | ASKNTHDTYDGSPH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|